About 4-[[4-amino-3,5-di(propan-2-yl)phenyl]methyl]-2,6-diethylaniline
4-[[4-amino-3,5-di(propan-2-yl)phenyl]methyl]-2,6-diethylaniline (PubChem CID 3016526) has the molecular formula C23H34N2
and a molecular weight of 338.54 g/mol. Its IUPAC name is 4-[[4-amino-3,5-di(propan-2-yl)phenyl]methyl]-2,6-diethylaniline.
Molecular Properties
| Compound Name | 4-[[4-amino-3,5-di(propan-2-yl)phenyl]methyl]-2,6-diethylaniline |
| PubChem CID | 3016526 |
| Molecular Formula | C23H34N2 |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.27 |
| IUPAC Name | 4-[[4-amino-3,5-di(propan-2-yl)phenyl]methyl]-2,6-diethylaniline |
| SMILES | CCc1cc(Cc2cc(C(C)C)c(N)c(C(C)C)c2)cc(CC)c1N |
| InChI | InChI=1S/C23H34N2/c1-7-18-10-16(11-19(8-2)22(18)24)9-17-12-20(14(3)4)23(25)21(13-17)15(5)6/h10-15H,7-9,24-25H2,1-6H3 |
| InChIKey | XOMUHHURHSJLDC-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-[[4-amino-3,5-di(propan-2-yl)phenyl]methyl]-2,6-diethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-amino-3,5-di(propan-2-yl)phenyl]methyl]-2,6-diethylaniline?
The IUPAC name of 4-[[4-amino-3,5-di(propan-2-yl)phenyl]methyl]-2,6-diethylaniline (CID 3016526) is 4-[[4-amino-3,5-di(propan-2-yl)phenyl]methyl]-2,6-diethylaniline.
What is the SMILES notation for 4-[[4-amino-3,5-di(propan-2-yl)phenyl]methyl]-2,6-diethylaniline?
The canonical SMILES for 4-[[4-amino-3,5-di(propan-2-yl)phenyl]methyl]-2,6-diethylaniline is CCc1cc(Cc2cc(C(C)C)c(N)c(C(C)C)c2)cc(CC)c1N.
What is the InChIKey of 4-[[4-amino-3,5-di(propan-2-yl)phenyl]methyl]-2,6-diethylaniline?
The InChIKey is XOMUHHURHSJLDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H34N2/c1-7-18-10-16(11-19(8-2)22(18)24)9-17-12-20(14(3)4)23(25)21(13-17)15(5)6/h10-15H,7-9,24-25H2,1-6H3.
What are the key properties of 4-[[4-amino-3,5-di(propan-2-yl)phenyl]methyl]-2,6-diethylaniline?
4-[[4-amino-3,5-di(propan-2-yl)phenyl]methyl]-2,6-diethylaniline has a molecular weight of 338.54 g/mol, XLogP of 5.81, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-amino-3,5-di(propan-2-yl)phenyl]methyl]-2,6-diethylaniline is sourced from PubChem (CID 3016526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).