About N-ethyl-2,3-dimethyl-2-propan-2-ylbutanamide
N-ethyl-2,3-dimethyl-2-propan-2-ylbutanamide (PubChem CID 3016599) has the molecular formula C11H23NO
and a molecular weight of 185.31 g/mol. Its IUPAC name is N-ethyl-2,3-dimethyl-2-propan-2-ylbutanamide.
Molecular Properties
| Compound Name | N-ethyl-2,3-dimethyl-2-propan-2-ylbutanamide |
| PubChem CID | 3016599 |
| Molecular Formula | C11H23NO |
| Molecular Weight | 185.31 g/mol |
| Exact Mass | 185.18 |
| IUPAC Name | N-ethyl-2,3-dimethyl-2-propan-2-ylbutanamide |
| SMILES | CCNC(=O)C(C)(C(C)C)C(C)C |
| InChI | InChI=1S/C11H23NO/c1-7-12-10(13)11(6,8(2)3)9(4)5/h8-9H,7H2,1-6H3,(H,12,13) |
| InChIKey | MLGQKMLAQSNRSE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.31 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze N-ethyl-2,3-dimethyl-2-propan-2-ylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-2,3-dimethyl-2-propan-2-ylbutanamide?
The IUPAC name of N-ethyl-2,3-dimethyl-2-propan-2-ylbutanamide (CID 3016599) is N-ethyl-2,3-dimethyl-2-propan-2-ylbutanamide.
What is the SMILES notation for N-ethyl-2,3-dimethyl-2-propan-2-ylbutanamide?
The canonical SMILES for N-ethyl-2,3-dimethyl-2-propan-2-ylbutanamide is CCNC(=O)C(C)(C(C)C)C(C)C.
What is the InChIKey of N-ethyl-2,3-dimethyl-2-propan-2-ylbutanamide?
The InChIKey is MLGQKMLAQSNRSE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23NO/c1-7-12-10(13)11(6,8(2)3)9(4)5/h8-9H,7H2,1-6H3,(H,12,13).
What are the key properties of N-ethyl-2,3-dimethyl-2-propan-2-ylbutanamide?
N-ethyl-2,3-dimethyl-2-propan-2-ylbutanamide has a molecular weight of 185.31 g/mol, XLogP of 2.44, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-2,3-dimethyl-2-propan-2-ylbutanamide is sourced from PubChem (CID 3016599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).