About 2-(dimethylamino)ethyl prop-2-enoate;hydrochloride
2-(dimethylamino)ethyl prop-2-enoate;hydrochloride (PubChem CID 3016712) has the molecular formula C7H14ClNO2
and a molecular weight of 179.65 g/mol. Its IUPAC name is 2-(dimethylamino)ethyl prop-2-enoate;hydrochloride.
Molecular Properties
| Compound Name | 2-(dimethylamino)ethyl prop-2-enoate;hydrochloride |
| PubChem CID | 3016712 |
| Molecular Formula | C7H14ClNO2 |
| Molecular Weight | 179.65 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | 2-(dimethylamino)ethyl prop-2-enoate;hydrochloride |
| SMILES | C=CC(=O)OCCN(C)C.Cl |
| InChI | InChI=1S/C7H13NO2.ClH/c1-4-7(9)10-6-5-8(2)3;/h4H,1,5-6H2,2-3H3;1H |
| InChIKey | SSZXAJUPVKMUJH-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.65 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-(dimethylamino)ethyl prop-2-enoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(dimethylamino)ethyl prop-2-enoate;hydrochloride?
The IUPAC name of 2-(dimethylamino)ethyl prop-2-enoate;hydrochloride (CID 3016712) is 2-(dimethylamino)ethyl prop-2-enoate;hydrochloride.
What is the SMILES notation for 2-(dimethylamino)ethyl prop-2-enoate;hydrochloride?
The canonical SMILES for 2-(dimethylamino)ethyl prop-2-enoate;hydrochloride is C=CC(=O)OCCN(C)C.Cl.
What is the InChIKey of 2-(dimethylamino)ethyl prop-2-enoate;hydrochloride?
The InChIKey is SSZXAJUPVKMUJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H13NO2.ClH/c1-4-7(9)10-6-5-8(2)3;/h4H,1,5-6H2,2-3H3;1H.
What are the key properties of 2-(dimethylamino)ethyl prop-2-enoate;hydrochloride?
2-(dimethylamino)ethyl prop-2-enoate;hydrochloride has a molecular weight of 179.65 g/mol, XLogP of 0.70, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(dimethylamino)ethyl prop-2-enoate;hydrochloride is sourced from PubChem (CID 3016712), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).