C14H8O6 — CID 3016789
1,3,6,8-tetrahydroxyanthracene-9,10-dione (PubChem CID 3016789) has the molecular formula C14H8O6 and a molecular weight of 272.21 g/mol. Its IUPAC name is 1,3,6,8-tetrahydroxyanthracene-9,10-dione.
| Compound Name | 1,3,6,8-tetrahydroxyanthracene-9,10-dione |
|---|---|
| PubChem CID | 3016789 |
| Molecular Formula | C14H8O6 |
| Molecular Weight | 272.21 g/mol |
| Exact Mass | 272.03 |
| IUPAC Name | 1,3,6,8-tetrahydroxyanthracene-9,10-dione |
| SMILES | O=C1c2cc(O)cc(O)c2C(=O)c2c(O)cc(O)cc21 |
| InChI | InChI=1S/C14H8O6/c15-5-1-7-11(9(17)3-5)14(20)12-8(13(7)19)2-6(16)4-10(12)18/h1-4,15-18H |
| InChIKey | NTGIIKCGBNGQAR-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 115.06 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.21 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|