About ethyl 2-benzylidenebutanoate
ethyl 2-benzylidenebutanoate (PubChem CID 3016849) has the molecular formula C13H16O2
and a molecular weight of 204.27 g/mol. Its IUPAC name is ethyl 2-benzylidenebutanoate.
Molecular Properties
| Compound Name | ethyl 2-benzylidenebutanoate |
| PubChem CID | 3016849 |
| Molecular Formula | C13H16O2 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.12 |
| IUPAC Name | ethyl 2-benzylidenebutanoate |
| SMILES | CCOC(=O)C(=Cc1ccccc1)CC |
| InChI | InChI=1S/C13H16O2/c1-3-12(13(14)15-4-2)10-11-8-6-5-7-9-11/h5-10H,3-4H2,1-2H3 |
| InChIKey | CMDBGQQPIQOIAK-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-benzylidenebutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-benzylidenebutanoate?
The IUPAC name of ethyl 2-benzylidenebutanoate (CID 3016849) is ethyl 2-benzylidenebutanoate.
What is the SMILES notation for ethyl 2-benzylidenebutanoate?
The canonical SMILES for ethyl 2-benzylidenebutanoate is CCOC(=O)C(=Cc1ccccc1)CC.
What is the InChIKey of ethyl 2-benzylidenebutanoate?
The InChIKey is CMDBGQQPIQOIAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H16O2/c1-3-12(13(14)15-4-2)10-11-8-6-5-7-9-11/h5-10H,3-4H2,1-2H3.
What are the key properties of ethyl 2-benzylidenebutanoate?
ethyl 2-benzylidenebutanoate has a molecular weight of 204.27 g/mol, XLogP of 3.04, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-benzylidenebutanoate is sourced from PubChem (CID 3016849), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).