About 1-(8-ethoxy-4,8-dimethylnonyl)-4-propan-2-ylbenzene
1-(8-ethoxy-4,8-dimethylnonyl)-4-propan-2-ylbenzene (PubChem CID 3016853) has the molecular formula C22H38O
and a molecular weight of 318.55 g/mol. Its IUPAC name is 1-(8-ethoxy-4,8-dimethylnonyl)-4-propan-2-ylbenzene.
Molecular Properties
| Compound Name | 1-(8-ethoxy-4,8-dimethylnonyl)-4-propan-2-ylbenzene |
| PubChem CID | 3016853 |
| Molecular Formula | C22H38O |
| Molecular Weight | 318.55 g/mol |
| Exact Mass | 318.29 |
| IUPAC Name | 1-(8-ethoxy-4,8-dimethylnonyl)-4-propan-2-ylbenzene |
| SMILES | CCOC(C)(C)CCCC(C)CCCc1ccc(C(C)C)cc1 |
| InChI | InChI=1S/C22H38O/c1-7-23-22(5,6)17-9-11-19(4)10-8-12-20-13-15-21(16-14-20)18(2)3/h13-16,18-19H,7-12,17H2,1-6H3 |
| InChIKey | IXAPJMBEOUOLIZ-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 318.55 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(8-ethoxy-4,8-dimethylnonyl)-4-propan-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(8-ethoxy-4,8-dimethylnonyl)-4-propan-2-ylbenzene?
The IUPAC name of 1-(8-ethoxy-4,8-dimethylnonyl)-4-propan-2-ylbenzene (CID 3016853) is 1-(8-ethoxy-4,8-dimethylnonyl)-4-propan-2-ylbenzene.
What is the SMILES notation for 1-(8-ethoxy-4,8-dimethylnonyl)-4-propan-2-ylbenzene?
The canonical SMILES for 1-(8-ethoxy-4,8-dimethylnonyl)-4-propan-2-ylbenzene is CCOC(C)(C)CCCC(C)CCCc1ccc(C(C)C)cc1.
What is the InChIKey of 1-(8-ethoxy-4,8-dimethylnonyl)-4-propan-2-ylbenzene?
The InChIKey is IXAPJMBEOUOLIZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H38O/c1-7-23-22(5,6)17-9-11-19(4)10-8-12-20-13-15-21(16-14-20)18(2)3/h13-16,18-19H,7-12,17H2,1-6H3.
What are the key properties of 1-(8-ethoxy-4,8-dimethylnonyl)-4-propan-2-ylbenzene?
1-(8-ethoxy-4,8-dimethylnonyl)-4-propan-2-ylbenzene has a molecular weight of 318.55 g/mol, XLogP of 6.75, 11 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(8-ethoxy-4,8-dimethylnonyl)-4-propan-2-ylbenzene is sourced from PubChem (CID 3016853), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).