About 2-sulfanylpropanal
2-sulfanylpropanal (PubChem CID 3016872) has the molecular formula C3H6OS
and a molecular weight of 90.15 g/mol. Its IUPAC name is 2-sulfanylpropanal.
Molecular Properties
| Compound Name | 2-sulfanylpropanal |
| PubChem CID | 3016872 |
| Molecular Formula | C3H6OS |
| Molecular Weight | 90.15 g/mol |
| Exact Mass | 90.01 |
| IUPAC Name | 2-sulfanylpropanal |
| SMILES | CC(S)C=O |
| InChI | InChI=1S/C3H6OS/c1-3(5)2-4/h2-3,5H,1H3 |
| InChIKey | KNZPMGNXOMIDTC-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 90.15 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanylpropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanylpropanal?
The IUPAC name of 2-sulfanylpropanal (CID 3016872) is 2-sulfanylpropanal.
What is the SMILES notation for 2-sulfanylpropanal?
The canonical SMILES for 2-sulfanylpropanal is CC(S)C=O.
What is the InChIKey of 2-sulfanylpropanal?
The InChIKey is KNZPMGNXOMIDTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6OS/c1-3(5)2-4/h2-3,5H,1H3.
What are the key properties of 2-sulfanylpropanal?
2-sulfanylpropanal has a molecular weight of 90.15 g/mol, XLogP of 0.50, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanylpropanal is sourced from PubChem (CID 3016872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).