C13H20N2O4S — CID 30168858
2-(2-ethoxy-N-methylsulfonylanilino)-N,N-dimethylacetamide (PubChem CID 30168858) has the molecular formula C13H20N2O4S and a molecular weight of 300.38 g/mol. Its IUPAC name is 2-(2-ethoxy-N-methylsulfonylanilino)-N,N-dimethylacetamide.
| Compound Name | 2-(2-ethoxy-N-methylsulfonylanilino)-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 30168858 |
| Molecular Formula | C13H20N2O4S |
| Molecular Weight | 300.38 g/mol |
| Exact Mass | 300.11 |
| IUPAC Name | 2-(2-ethoxy-N-methylsulfonylanilino)-N,N-dimethylacetamide |
| SMILES | CCOc1ccccc1N(CC(=O)N(C)C)S(C)(=O)=O |
| InChI | InChI=1S/C13H20N2O4S/c1-5-19-12-9-7-6-8-11(12)15(20(4,17)18)10-13(16)14(2)3/h6-9H,5,10H2,1-4H3 |
| InChIKey | IECRSJDWVOLGIZ-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 66.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.38 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |