About 2,6-dimethoxypyridine-3,5-diamine
2,6-dimethoxypyridine-3,5-diamine (PubChem CID 3017020) has the molecular formula C7H11N3O2
and a molecular weight of 169.18 g/mol. Its IUPAC name is 2,6-dimethoxypyridine-3,5-diamine.
Molecular Properties
| Compound Name | 2,6-dimethoxypyridine-3,5-diamine |
| PubChem CID | 3017020 |
| Molecular Formula | C7H11N3O2 |
| Molecular Weight | 169.18 g/mol |
| Exact Mass | 169.09 |
| IUPAC Name | 2,6-dimethoxypyridine-3,5-diamine |
| SMILES | COc1nc(OC)c(N)cc1N |
| InChI | InChI=1S/C7H11N3O2/c1-11-6-4(8)3-5(9)7(10-6)12-2/h3H,8-9H2,1-2H3 |
| InChIKey | BXBOXUNPNIJELB-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 83.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.18 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2,6-dimethoxypyridine-3,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-dimethoxypyridine-3,5-diamine?
The IUPAC name of 2,6-dimethoxypyridine-3,5-diamine (CID 3017020) is 2,6-dimethoxypyridine-3,5-diamine.
What is the SMILES notation for 2,6-dimethoxypyridine-3,5-diamine?
The canonical SMILES for 2,6-dimethoxypyridine-3,5-diamine is COc1nc(OC)c(N)cc1N.
What is the InChIKey of 2,6-dimethoxypyridine-3,5-diamine?
The InChIKey is BXBOXUNPNIJELB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N3O2/c1-11-6-4(8)3-5(9)7(10-6)12-2/h3H,8-9H2,1-2H3.
What are the key properties of 2,6-dimethoxypyridine-3,5-diamine?
2,6-dimethoxypyridine-3,5-diamine has a molecular weight of 169.18 g/mol, XLogP of 0.26, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-dimethoxypyridine-3,5-diamine is sourced from PubChem (CID 3017020), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).