About 2-cyanoguanidine;hydrochloride
2-cyanoguanidine;hydrochloride (PubChem CID 3017105) has the molecular formula C2H5ClN4
and a molecular weight of 120.54 g/mol. Its IUPAC name is 2-cyanoguanidine;hydrochloride.
Molecular Properties
| Compound Name | 2-cyanoguanidine;hydrochloride |
| PubChem CID | 3017105 |
| Molecular Formula | C2H5ClN4 |
| Molecular Weight | 120.54 g/mol |
| Exact Mass | 120.02 |
| IUPAC Name | 2-cyanoguanidine;hydrochloride |
| SMILES | Cl.N#CN=C(N)N |
| InChI | InChI=1S/C2H4N4.ClH/c3-1-6-2(4)5;/h(H4,4,5,6);1H |
| InChIKey | XFUXGQBTPGTUMC-UHFFFAOYSA-N |
| XLogP | -0.84 |
| TPSA | 88.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 120.54 |
| LogP ≤ 5 | -0.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-cyanoguanidine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyanoguanidine;hydrochloride?
The IUPAC name of 2-cyanoguanidine;hydrochloride (CID 3017105) is 2-cyanoguanidine;hydrochloride.
What is the SMILES notation for 2-cyanoguanidine;hydrochloride?
The canonical SMILES for 2-cyanoguanidine;hydrochloride is Cl.N#CN=C(N)N.
What is the InChIKey of 2-cyanoguanidine;hydrochloride?
The InChIKey is XFUXGQBTPGTUMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4N4.ClH/c3-1-6-2(4)5;/h(H4,4,5,6);1H.
What are the key properties of 2-cyanoguanidine;hydrochloride?
2-cyanoguanidine;hydrochloride has a molecular weight of 120.54 g/mol, XLogP of -0.84, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyanoguanidine;hydrochloride is sourced from PubChem (CID 3017105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).