C12H4ClF11O3S — CID 3017140
4-(1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy)benzenesulfonyl chloride (PubChem CID 3017140) has the molecular formula C12H4ClF11O3S and a molecular weight of 472.66 g/mol. Its IUPAC name is 4-(1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy)benzenesulfonyl chloride.
| Compound Name | 4-(1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy)benzenesulfonyl chloride |
|---|---|
| PubChem CID | 3017140 |
| Molecular Formula | C12H4ClF11O3S |
| Molecular Weight | 472.66 g/mol |
| Exact Mass | 471.94 |
| IUPAC Name | 4-(1,2,3,3,4,4,5,5,6,6,6-undecafluorohex-1-enoxy)benzenesulfonyl chloride |
| SMILES | O=S(=O)(Cl)c1ccc(OC(F)=C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C12H4ClF11O3S/c13-28(25,26)6-3-1-5(2-4-6)27-8(15)7(14)9(16,17)10(18,19)11(20,21)12(22,23)24/h1-4H |
| InChIKey | JHPOMBWYTNUPKL-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.66 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|