C28H27N3O3 — CID 30171432
(3aR,4S,9bS)-N-[(3,4-dimethylphenyl)methyl]-4-(4-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide (PubChem CID 30171432) has the molecular formula C28H27N3O3 and a molecular weight of 453.54 g/mol. Its IUPAC name is (3aR,4S,9bS)-N-[(3,4-dimethylphenyl)methyl]-4-(4-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide.
| Compound Name | (3aR,4S,9bS)-N-[(3,4-dimethylphenyl)methyl]-4-(4-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide |
|---|---|
| PubChem CID | 30171432 |
| Molecular Formula | C28H27N3O3 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.21 |
| IUPAC Name | (3aR,4S,9bS)-N-[(3,4-dimethylphenyl)methyl]-4-(4-nitrophenyl)-3a,4,5,9b-tetrahydro-3H-cyclopenta[c]quinoline-8-carboxamide |
| SMILES | Cc1ccc(CNC(=O)c2ccc3c(c2)[C@H]2C=CC[C@H]2[C@@H](c2ccc([N+](=O)[O-])cc2)N3)cc1C |
| InChI | InChI=1S/C28H27N3O3/c1-17-6-7-19(14-18(17)2)16-29-28(32)21-10-13-26-25(15-21)23-4-3-5-24(23)27(30-26)20-8-11-22(12-9-20)31(33)34/h3-4,6-15,23-24,27,30H,5,16H2,1-2H3,(H,29,32)/t23-,24+,27+/m0/s1 |
| InChIKey | DHHKXFZQQNWVNJ-CLCZQPDDSA-N |
| XLogP | 5.97 |
| TPSA | 84.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_alk_ene(51)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|