C20H42N4 — CID 3017249
N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)ethane-1,2-diamine (PubChem CID 3017249) has the molecular formula C20H42N4 and a molecular weight of 338.58 g/mol. Its IUPAC name is N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)ethane-1,2-diamine.
| Compound Name | N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 3017249 |
| Molecular Formula | C20H42N4 |
| Molecular Weight | 338.58 g/mol |
| Exact Mass | 338.34 |
| IUPAC Name | N,N'-bis(2,2,6,6-tetramethylpiperidin-4-yl)ethane-1,2-diamine |
| SMILES | CC1(C)CC(NCCNC2CC(C)(C)NC(C)(C)C2)CC(C)(C)N1 |
| InChI | InChI=1S/C20H42N4/c1-17(2)11-15(12-18(3,4)23-17)21-9-10-22-16-13-19(5,6)24-20(7,8)14-16/h15-16,21-24H,9-14H2,1-8H3 |
| InChIKey | OFXVCLLHEWMVEQ-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 48.12 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.58 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|