About 3-amino-2,4-dichlorophenol
3-amino-2,4-dichlorophenol (PubChem CID 3017276) has the molecular formula C6H5Cl2NO
and a molecular weight of 178.02 g/mol. Its IUPAC name is 3-amino-2,4-dichlorophenol.
Molecular Properties
| Compound Name | 3-amino-2,4-dichlorophenol |
| PubChem CID | 3017276 |
| Molecular Formula | C6H5Cl2NO |
| Molecular Weight | 178.02 g/mol |
| Exact Mass | 176.97 |
| IUPAC Name | 3-amino-2,4-dichlorophenol |
| SMILES | Nc1c(Cl)ccc(O)c1Cl |
| InChI | InChI=1S/C6H5Cl2NO/c7-3-1-2-4(10)5(8)6(3)9/h1-2,10H,9H2 |
| InChIKey | SYRZWFBWUASJJI-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 178.02 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-amino-2,4-dichlorophenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2,4-dichlorophenol?
The IUPAC name of 3-amino-2,4-dichlorophenol (CID 3017276) is 3-amino-2,4-dichlorophenol.
What is the SMILES notation for 3-amino-2,4-dichlorophenol?
The canonical SMILES for 3-amino-2,4-dichlorophenol is Nc1c(Cl)ccc(O)c1Cl.
What is the InChIKey of 3-amino-2,4-dichlorophenol?
The InChIKey is SYRZWFBWUASJJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H5Cl2NO/c7-3-1-2-4(10)5(8)6(3)9/h1-2,10H,9H2.
What are the key properties of 3-amino-2,4-dichlorophenol?
3-amino-2,4-dichlorophenol has a molecular weight of 178.02 g/mol, XLogP of 2.28, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2,4-dichlorophenol is sourced from PubChem (CID 3017276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).