About 2-aminobenzene-1,4-diol
2-aminobenzene-1,4-diol (PubChem CID 3017497) has the molecular formula C6H7NO2
and a molecular weight of 125.13 g/mol. Its IUPAC name is 2-aminobenzene-1,4-diol.
Molecular Properties
| Compound Name | 2-aminobenzene-1,4-diol |
| PubChem CID | 3017497 |
| Molecular Formula | C6H7NO2 |
| Molecular Weight | 125.13 g/mol |
| Exact Mass | 125.05 |
| IUPAC Name | 2-aminobenzene-1,4-diol |
| SMILES | Nc1cc(O)ccc1O |
| InChI | InChI=1S/C6H7NO2/c7-5-3-4(8)1-2-6(5)9/h1-3,8-9H,7H2 |
| InChIKey | SBXKRBZKPQBLOD-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.13 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 2-aminobenzene-1,4-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobenzene-1,4-diol?
The IUPAC name of 2-aminobenzene-1,4-diol (CID 3017497) is 2-aminobenzene-1,4-diol.
What is the SMILES notation for 2-aminobenzene-1,4-diol?
The canonical SMILES for 2-aminobenzene-1,4-diol is Nc1cc(O)ccc1O.
What is the InChIKey of 2-aminobenzene-1,4-diol?
The InChIKey is SBXKRBZKPQBLOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2/c7-5-3-4(8)1-2-6(5)9/h1-3,8-9H,7H2.
What are the key properties of 2-aminobenzene-1,4-diol?
2-aminobenzene-1,4-diol has a molecular weight of 125.13 g/mol, XLogP of 0.68, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobenzene-1,4-diol is sourced from PubChem (CID 3017497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).