C12H13N3O4 — CID 30176058
8-(furan-3-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 30176058) has the molecular formula C12H13N3O4 and a molecular weight of 263.25 g/mol. Its IUPAC name is 8-(furan-3-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-(furan-3-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 30176058 |
| Molecular Formula | C12H13N3O4 |
| Molecular Weight | 263.25 g/mol |
| Exact Mass | 263.09 |
| IUPAC Name | 8-(furan-3-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCN(C(=O)c3ccoc3)CC2)N1 |
| InChI | InChI=1S/C12H13N3O4/c16-9(8-1-6-19-7-8)15-4-2-12(3-5-15)10(17)13-11(18)14-12/h1,6-7H,2-5H2,(H2,13,14,17,18) |
| InChIKey | IRZLQYSRPRUSMA-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.25 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|