About N-benzyl-N-methylglycine
N-benzyl-N-methylglycine (PubChem CID 301761) has the molecular formula C10H13NO2
and a molecular weight of 179.22 g/mol. Its IUPAC name is 2-[benzyl(methyl)amino]acetic acid.
Molecular Properties
| Compound Name | N-benzyl-N-methylglycine |
| PubChem CID | 301761 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 2-[benzyl(methyl)amino]acetic acid |
| SMILES | CN(CC1=CC=CC=C1)CC(=O)O |
| InChI | InChI=1S/C10H13NO2/c1-11(8-10(12)13)7-9-5-3-2-4-6-9/h2-6H,7-8H2,1H3,(H,12,13) |
| InChIKey | OZKZHAPLKMRAQT-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 40.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | 164 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-benzyl-N-methylglycine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N-methylglycine?
The IUPAC name of N-benzyl-N-methylglycine (CID 301761) is 2-[benzyl(methyl)amino]acetic acid.
What is the SMILES notation for N-benzyl-N-methylglycine?
The canonical SMILES for N-benzyl-N-methylglycine is CN(CC1=CC=CC=C1)CC(=O)O.
What is the InChIKey of N-benzyl-N-methylglycine?
The InChIKey is OZKZHAPLKMRAQT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13NO2/c1-11(8-10(12)13)7-9-5-3-2-4-6-9/h2-6H,7-8H2,1H3,(H,12,13).
What are the key properties of N-benzyl-N-methylglycine?
N-benzyl-N-methylglycine has a molecular weight of 179.22 g/mol, XLogP of -0.90, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N-methylglycine is sourced from PubChem (CID 301761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).