C12H12ClN3O4 — CID 30176120
8-(5-chlorofuran-2-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione (PubChem CID 30176120) has the molecular formula C12H12ClN3O4 and a molecular weight of 297.70 g/mol. Its IUPAC name is 8-(5-chlorofuran-2-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione.
| Compound Name | 8-(5-chlorofuran-2-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
|---|---|
| PubChem CID | 30176120 |
| Molecular Formula | C12H12ClN3O4 |
| Molecular Weight | 297.70 g/mol |
| Exact Mass | 297.05 |
| IUPAC Name | 8-(5-chlorofuran-2-carbonyl)-1,3,8-triazaspiro[4.5]decane-2,4-dione |
| SMILES | O=C1NC(=O)C2(CCN(C(=O)c3ccc(Cl)o3)CC2)N1 |
| InChI | InChI=1S/C12H12ClN3O4/c13-8-2-1-7(20-8)9(17)16-5-3-12(4-6-16)10(18)14-11(19)15-12/h1-2H,3-6H2,(H2,14,15,18,19) |
| InChIKey | UWFYGAUZGRACQO-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.70 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|