C7H6F8O — CID 3017673
5-ethenoxy-1,1,2,2,3,3,4,4-octafluoropentane (PubChem CID 3017673) has the molecular formula C7H6F8O and a molecular weight of 258.11 g/mol. Its IUPAC name is 5-ethenoxy-1,1,2,2,3,3,4,4-octafluoropentane.
| Compound Name | 5-ethenoxy-1,1,2,2,3,3,4,4-octafluoropentane |
|---|---|
| PubChem CID | 3017673 |
| Molecular Formula | C7H6F8O |
| Molecular Weight | 258.11 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | 5-ethenoxy-1,1,2,2,3,3,4,4-octafluoropentane |
| SMILES | C=COCC(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C7H6F8O/c1-2-16-3-5(10,11)7(14,15)6(12,13)4(8)9/h2,4H,1,3H2 |
| InChIKey | LIXQMBUPLJAAOE-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.11 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|