About 2-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]ethanol
2-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]ethanol (PubChem CID 3017677) has the molecular formula C12H26N2O
and a molecular weight of 214.35 g/mol. Its IUPAC name is 2-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]ethanol.
Molecular Properties
| Compound Name | 2-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]ethanol |
| PubChem CID | 3017677 |
| Molecular Formula | C12H26N2O |
| Molecular Weight | 214.35 g/mol |
| Exact Mass | 214.20 |
| IUPAC Name | 2-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]ethanol |
| SMILES | CC1(C)CC(N)CC(C)(CNCCO)C1 |
| InChI | InChI=1S/C12H26N2O/c1-11(2)6-10(13)7-12(3,8-11)9-14-4-5-15/h10,14-15H,4-9,13H2,1-3H3 |
| InChIKey | QWLUUZCNBWLTQM-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.35 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]ethanol?
The IUPAC name of 2-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]ethanol (CID 3017677) is 2-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]ethanol.
What is the SMILES notation for 2-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]ethanol?
The canonical SMILES for 2-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]ethanol is CC1(C)CC(N)CC(C)(CNCCO)C1.
What is the InChIKey of 2-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]ethanol?
The InChIKey is QWLUUZCNBWLTQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26N2O/c1-11(2)6-10(13)7-12(3,8-11)9-14-4-5-15/h10,14-15H,4-9,13H2,1-3H3.
What are the key properties of 2-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]ethanol?
2-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]ethanol has a molecular weight of 214.35 g/mol, XLogP of 1.11, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]ethanol is sourced from PubChem (CID 3017677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).