About 1-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]propan-2-ol
1-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]propan-2-ol (PubChem CID 3017678) has the molecular formula C13H28N2O
and a molecular weight of 228.38 g/mol. Its IUPAC name is 1-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]propan-2-ol.
Molecular Properties
| Compound Name | 1-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]propan-2-ol |
| PubChem CID | 3017678 |
| Molecular Formula | C13H28N2O |
| Molecular Weight | 228.38 g/mol |
| Exact Mass | 228.22 |
| IUPAC Name | 1-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]propan-2-ol |
| SMILES | CC(O)CNCC1(C)CC(N)CC(C)(C)C1 |
| InChI | InChI=1S/C13H28N2O/c1-10(16)7-15-9-13(4)6-11(14)5-12(2,3)8-13/h10-11,15-16H,5-9,14H2,1-4H3 |
| InChIKey | QUQZYDPUJYFFMD-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 58.28 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.38 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]propan-2-ol?
The IUPAC name of 1-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]propan-2-ol (CID 3017678) is 1-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]propan-2-ol.
What is the SMILES notation for 1-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]propan-2-ol?
The canonical SMILES for 1-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]propan-2-ol is CC(O)CNCC1(C)CC(N)CC(C)(C)C1.
What is the InChIKey of 1-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]propan-2-ol?
The InChIKey is QUQZYDPUJYFFMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H28N2O/c1-10(16)7-15-9-13(4)6-11(14)5-12(2,3)8-13/h10-11,15-16H,5-9,14H2,1-4H3.
What are the key properties of 1-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]propan-2-ol?
1-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]propan-2-ol has a molecular weight of 228.38 g/mol, XLogP of 1.50, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(5-amino-1,3,3-trimethylcyclohexyl)methylamino]propan-2-ol is sourced from PubChem (CID 3017678), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).