C17H13N3O4S — CID 30177342
(2-nitrophenyl)methyl 4-methyl-2-pyridin-2-yl-1,3-thiazole-5-carboxylate (PubChem CID 30177342) has the molecular formula C17H13N3O4S and a molecular weight of 355.38 g/mol. Its IUPAC name is (2-nitrophenyl)methyl 4-methyl-2-pyridin-2-yl-1,3-thiazole-5-carboxylate.
| Compound Name | (2-nitrophenyl)methyl 4-methyl-2-pyridin-2-yl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 30177342 |
| Molecular Formula | C17H13N3O4S |
| Molecular Weight | 355.38 g/mol |
| Exact Mass | 355.06 |
| IUPAC Name | (2-nitrophenyl)methyl 4-methyl-2-pyridin-2-yl-1,3-thiazole-5-carboxylate |
| SMILES | Cc1nc(-c2ccccn2)sc1C(=O)OCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H13N3O4S/c1-11-15(25-16(19-11)13-7-4-5-9-18-13)17(21)24-10-12-6-2-3-8-14(12)20(22)23/h2-9H,10H2,1H3 |
| InChIKey | MXMNPUYEEAPUJE-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 95.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.38 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|