About 2,3,3,5-tetramethyl-1-propan-2-yl-1,2-dihydroindene
2,3,3,5-tetramethyl-1-propan-2-yl-1,2-dihydroindene (PubChem CID 3017888) has the molecular formula C16H24
and a molecular weight of 216.37 g/mol. Its IUPAC name is 2,3,3,5-tetramethyl-1-propan-2-yl-1,2-dihydroindene.
Analyze 2,3,3,5-tetramethyl-1-propan-2-yl-1,2-dihydroindene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3,3,5-tetramethyl-1-propan-2-yl-1,2-dihydroindene?
The IUPAC name of 2,3,3,5-tetramethyl-1-propan-2-yl-1,2-dihydroindene (CID 3017888) is 2,3,3,5-tetramethyl-1-propan-2-yl-1,2-dihydroindene.
What is the SMILES notation for 2,3,3,5-tetramethyl-1-propan-2-yl-1,2-dihydroindene?
The canonical SMILES for 2,3,3,5-tetramethyl-1-propan-2-yl-1,2-dihydroindene is Cc1ccc2c(c1)C(C)(C)C(C)C2C(C)C.
What is the InChIKey of 2,3,3,5-tetramethyl-1-propan-2-yl-1,2-dihydroindene?
The InChIKey is JLVMQRKTHPQUBM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24/c1-10(2)15-12(4)16(5,6)14-9-11(3)7-8-13(14)15/h7-10,12,15H,1-6H3.
What are the key properties of 2,3,3,5-tetramethyl-1-propan-2-yl-1,2-dihydroindene?
2,3,3,5-tetramethyl-1-propan-2-yl-1,2-dihydroindene has a molecular weight of 216.37 g/mol, XLogP of 4.66, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3,3,5-tetramethyl-1-propan-2-yl-1,2-dihydroindene is sourced from PubChem (CID 3017888), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).