C20H15FN2O5S2 — CID 30180317
(2-nitrophenyl)methyl 3-[(5E)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate (PubChem CID 30180317) has the molecular formula C20H15FN2O5S2 and a molecular weight of 446.48 g/mol. Its IUPAC name is (2-nitrophenyl)methyl 3-[(5E)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate.
| Compound Name | (2-nitrophenyl)methyl 3-[(5E)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate |
|---|---|
| PubChem CID | 30180317 |
| Molecular Formula | C20H15FN2O5S2 |
| Molecular Weight | 446.48 g/mol |
| Exact Mass | 446.04 |
| IUPAC Name | (2-nitrophenyl)methyl 3-[(5E)-5-[(4-fluorophenyl)methylidene]-4-oxo-2-sulfanylidene-1,3-thiazolidin-3-yl]propanoate |
| SMILES | O=C(CCN1C(=O)/C(=C\c2ccc(F)cc2)SC1=S)OCc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H15FN2O5S2/c21-15-7-5-13(6-8-15)11-17-19(25)22(20(29)30-17)10-9-18(24)28-12-14-3-1-2-4-16(14)23(26)27/h1-8,11H,9-10,12H2/b17-11+ |
| InChIKey | YETHYFPOSYMTSZ-GZTJUZNOSA-N |
| XLogP | 4.07 |
| TPSA | 89.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.48 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|