C20H39N3 — CID 3018055
1,2-bis[(1-aminocyclohexyl)methyl]cyclohexan-1-amine (PubChem CID 3018055) has the molecular formula C20H39N3 and a molecular weight of 321.55 g/mol. Its IUPAC name is 1,2-bis[(1-aminocyclohexyl)methyl]cyclohexan-1-amine.
| Compound Name | 1,2-bis[(1-aminocyclohexyl)methyl]cyclohexan-1-amine |
|---|---|
| PubChem CID | 3018055 |
| Molecular Formula | C20H39N3 |
| Molecular Weight | 321.55 g/mol |
| Exact Mass | 321.31 |
| IUPAC Name | 1,2-bis[(1-aminocyclohexyl)methyl]cyclohexan-1-amine |
| SMILES | NC1(CC2CCCCC2(N)CC2(N)CCCCC2)CCCCC1 |
| InChI | InChI=1S/C20H39N3/c21-18(10-4-1-5-11-18)15-17-9-3-8-14-20(17,23)16-19(22)12-6-2-7-13-19/h17H,1-16,21-23H2 |
| InChIKey | YRVFHWMKBKOMNZ-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.55 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |