C14H28N2O3 — CID 3018236
1,3-bis(3-hydroxy-2,2-dimethylpropyl)-1,3-diazinan-2-one (PubChem CID 3018236) has the molecular formula C14H28N2O3 and a molecular weight of 272.39 g/mol. Its IUPAC name is 1,3-bis(3-hydroxy-2,2-dimethylpropyl)-1,3-diazinan-2-one.
| Compound Name | 1,3-bis(3-hydroxy-2,2-dimethylpropyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 3018236 |
| Molecular Formula | C14H28N2O3 |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.21 |
| IUPAC Name | 1,3-bis(3-hydroxy-2,2-dimethylpropyl)-1,3-diazinan-2-one |
| SMILES | CC(C)(CO)CN1CCCN(CC(C)(C)CO)C1=O |
| InChI | InChI=1S/C14H28N2O3/c1-13(2,10-17)8-15-6-5-7-16(12(15)19)9-14(3,4)11-18/h17-18H,5-11H2,1-4H3 |
| InChIKey | DIDLCHLFJFQPII-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 64.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |