About [(S)-phenyl-(3,4,4-trimethyl-5-oxopyrazol-1-yl)methyl]urea
[(S)-phenyl-(3,4,4-trimethyl-5-oxopyrazol-1-yl)methyl]urea (PubChem CID 30182764) has the molecular formula C14H18N4O2
and a molecular weight of 274.32 g/mol. Its IUPAC name is [(S)-phenyl-(3,4,4-trimethyl-5-oxopyrazol-1-yl)methyl]urea.
Molecular Properties
| Compound Name | [(S)-phenyl-(3,4,4-trimethyl-5-oxopyrazol-1-yl)methyl]urea |
| PubChem CID | 30182764 |
| Molecular Formula | C14H18N4O2 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | [(S)-phenyl-(3,4,4-trimethyl-5-oxopyrazol-1-yl)methyl]urea |
| SMILES | CC1=NN([C@H](NC(N)=O)c2ccccc2)C(=O)C1(C)C |
| InChI | InChI=1S/C14H18N4O2/c1-9-14(2,3)12(19)18(17-9)11(16-13(15)20)10-7-5-4-6-8-10/h4-8,11H,1-3H3,(H3,15,16,20)/t11-/m0/s1 |
| InChIKey | UGJCEUINZUTMPX-NSHDSACASA-N |
| XLogP | 1.60 |
| TPSA | 87.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(S)-phenyl-(3,4,4-trimethyl-5-oxopyrazol-1-yl)methyl]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(S)-phenyl-(3,4,4-trimethyl-5-oxopyrazol-1-yl)methyl]urea?
The IUPAC name of [(S)-phenyl-(3,4,4-trimethyl-5-oxopyrazol-1-yl)methyl]urea (CID 30182764) is [(S)-phenyl-(3,4,4-trimethyl-5-oxopyrazol-1-yl)methyl]urea.
What is the SMILES notation for [(S)-phenyl-(3,4,4-trimethyl-5-oxopyrazol-1-yl)methyl]urea?
The canonical SMILES for [(S)-phenyl-(3,4,4-trimethyl-5-oxopyrazol-1-yl)methyl]urea is CC1=NN([C@H](NC(N)=O)c2ccccc2)C(=O)C1(C)C.
What is the InChIKey of [(S)-phenyl-(3,4,4-trimethyl-5-oxopyrazol-1-yl)methyl]urea?
The InChIKey is UGJCEUINZUTMPX-NSHDSACASA-N. The full InChI is InChI=1S/C14H18N4O2/c1-9-14(2,3)12(19)18(17-9)11(16-13(15)20)10-7-5-4-6-8-10/h4-8,11H,1-3H3,(H3,15,16,20)/t11-/m0/s1.
What are the key properties of [(S)-phenyl-(3,4,4-trimethyl-5-oxopyrazol-1-yl)methyl]urea?
[(S)-phenyl-(3,4,4-trimethyl-5-oxopyrazol-1-yl)methyl]urea has a molecular weight of 274.32 g/mol, XLogP of 1.60, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(S)-phenyl-(3,4,4-trimethyl-5-oxopyrazol-1-yl)methyl]urea is sourced from PubChem (CID 30182764), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).