C12H15N3OS — CID 30183297
N-(2-propan-2-ylpyrazol-3-yl)-2-thiophen-3-ylacetamide (PubChem CID 30183297) has the molecular formula C12H15N3OS and a molecular weight of 249.34 g/mol. Its IUPAC name is N-(2-propan-2-ylpyrazol-3-yl)-2-thiophen-3-ylacetamide.
| Compound Name | N-(2-propan-2-ylpyrazol-3-yl)-2-thiophen-3-ylacetamide |
|---|---|
| PubChem CID | 30183297 |
| Molecular Formula | C12H15N3OS |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | N-(2-propan-2-ylpyrazol-3-yl)-2-thiophen-3-ylacetamide |
| SMILES | CC(C)n1nccc1NC(=O)Cc1ccsc1 |
| InChI | InChI=1S/C12H15N3OS/c1-9(2)15-11(3-5-13-15)14-12(16)7-10-4-6-17-8-10/h3-6,8-9H,7H2,1-2H3,(H,14,16) |
| InChIKey | PZRVVBCBWAVKCX-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |