About 1-[4-[2-(diethylamino)ethoxy]phenyl]-1,2-diphenylethanol
1-[4-[2-(diethylamino)ethoxy]phenyl]-1,2-diphenylethanol (PubChem CID 3018431) has the molecular formula C26H31NO2
and a molecular weight of 389.54 g/mol. Its IUPAC name is 1-[4-[2-(diethylamino)ethoxy]phenyl]-1,2-diphenylethanol.
Molecular Properties
| Compound Name | 1-[4-[2-(diethylamino)ethoxy]phenyl]-1,2-diphenylethanol |
| PubChem CID | 3018431 |
| Molecular Formula | C26H31NO2 |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | 1-[4-[2-(diethylamino)ethoxy]phenyl]-1,2-diphenylethanol |
| SMILES | CCN(CC)CCOc1ccc(C(O)(Cc2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H31NO2/c1-3-27(4-2)19-20-29-25-17-15-24(16-18-25)26(28,23-13-9-6-10-14-23)21-22-11-7-5-8-12-22/h5-18,28H,3-4,19-21H2,1-2H3 |
| InChIKey | ZHLXWJSSVXYFJC-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[4-[2-(diethylamino)ethoxy]phenyl]-1,2-diphenylethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[2-(diethylamino)ethoxy]phenyl]-1,2-diphenylethanol?
The IUPAC name of 1-[4-[2-(diethylamino)ethoxy]phenyl]-1,2-diphenylethanol (CID 3018431) is 1-[4-[2-(diethylamino)ethoxy]phenyl]-1,2-diphenylethanol.
What is the SMILES notation for 1-[4-[2-(diethylamino)ethoxy]phenyl]-1,2-diphenylethanol?
The canonical SMILES for 1-[4-[2-(diethylamino)ethoxy]phenyl]-1,2-diphenylethanol is CCN(CC)CCOc1ccc(C(O)(Cc2ccccc2)c2ccccc2)cc1.
What is the InChIKey of 1-[4-[2-(diethylamino)ethoxy]phenyl]-1,2-diphenylethanol?
The InChIKey is ZHLXWJSSVXYFJC-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H31NO2/c1-3-27(4-2)19-20-29-25-17-15-24(16-18-25)26(28,23-13-9-6-10-14-23)21-22-11-7-5-8-12-22/h5-18,28H,3-4,19-21H2,1-2H3.
What are the key properties of 1-[4-[2-(diethylamino)ethoxy]phenyl]-1,2-diphenylethanol?
1-[4-[2-(diethylamino)ethoxy]phenyl]-1,2-diphenylethanol has a molecular weight of 389.54 g/mol, XLogP of 4.89, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[2-(diethylamino)ethoxy]phenyl]-1,2-diphenylethanol is sourced from PubChem (CID 3018431), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).