About 1,3-thiazole-5-carboxamide
1,3-thiazole-5-carboxamide (PubChem CID 3018505) has the molecular formula C4H4N2OS
and a molecular weight of 128.16 g/mol. Its IUPAC name is 1,3-thiazole-5-carboxamide.
Molecular Properties
| Compound Name | 1,3-thiazole-5-carboxamide |
| PubChem CID | 3018505 |
| Molecular Formula | C4H4N2OS |
| Molecular Weight | 128.16 g/mol |
| Exact Mass | 128.00 |
| IUPAC Name | 1,3-thiazole-5-carboxamide |
| SMILES | NC(=O)c1cncs1 |
| InChI | InChI=1S/C4H4N2OS/c5-4(7)3-1-6-2-8-3/h1-2H,(H2,5,7) |
| InChIKey | GGNIKGLUPSHSBV-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.16 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3-thiazole-5-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-thiazole-5-carboxamide?
The IUPAC name of 1,3-thiazole-5-carboxamide (CID 3018505) is 1,3-thiazole-5-carboxamide.
What is the SMILES notation for 1,3-thiazole-5-carboxamide?
The canonical SMILES for 1,3-thiazole-5-carboxamide is NC(=O)c1cncs1.
What is the InChIKey of 1,3-thiazole-5-carboxamide?
The InChIKey is GGNIKGLUPSHSBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H4N2OS/c5-4(7)3-1-6-2-8-3/h1-2H,(H2,5,7).
What are the key properties of 1,3-thiazole-5-carboxamide?
1,3-thiazole-5-carboxamide has a molecular weight of 128.16 g/mol, XLogP of 0.24, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-thiazole-5-carboxamide is sourced from PubChem (CID 3018505), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).