C11H20O2 — CID 3018524
1,1-bis(prop-2-enoxy)pentane (PubChem CID 3018524) has the molecular formula C11H20O2 and a molecular weight of 184.28 g/mol. Its IUPAC name is 1,1-bis(prop-2-enoxy)pentane.
| Compound Name | 1,1-bis(prop-2-enoxy)pentane |
|---|---|
| PubChem CID | 3018524 |
| Molecular Formula | C11H20O2 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.15 |
| IUPAC Name | 1,1-bis(prop-2-enoxy)pentane |
| SMILES | C=CCOC(CCCC)OCC=C |
| InChI | InChI=1S/C11H20O2/c1-4-7-8-11(12-9-5-2)13-10-6-3/h5-6,11H,2-4,7-10H2,1H3 |
| InChIKey | KWRBYSVDENXDJB-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|