C12H23NO — CID 3018643
4-ethenoxy-1,2,2,6,6-pentamethylpiperidine (PubChem CID 3018643) has the molecular formula C12H23NO and a molecular weight of 197.32 g/mol. Its IUPAC name is 4-ethenoxy-1,2,2,6,6-pentamethylpiperidine.
| Compound Name | 4-ethenoxy-1,2,2,6,6-pentamethylpiperidine |
|---|---|
| PubChem CID | 3018643 |
| Molecular Formula | C12H23NO |
| Molecular Weight | 197.32 g/mol |
| Exact Mass | 197.18 |
| IUPAC Name | 4-ethenoxy-1,2,2,6,6-pentamethylpiperidine |
| SMILES | C=COC1CC(C)(C)N(C)C(C)(C)C1 |
| InChI | InChI=1S/C12H23NO/c1-7-14-10-8-11(2,3)13(6)12(4,5)9-10/h7,10H,1,8-9H2,2-6H3 |
| InChIKey | OJQZHTMCZVPUCF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.32 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|