About N-decylprop-2-enamide
N-decylprop-2-enamide (PubChem CID 3018705) has the molecular formula C13H25NO
and a molecular weight of 211.35 g/mol. Its IUPAC name is N-decylprop-2-enamide.
Molecular Properties
| Compound Name | N-decylprop-2-enamide |
| PubChem CID | 3018705 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | N-decylprop-2-enamide |
| SMILES | C=CC(=O)NCCCCCCCCCC |
| InChI | InChI=1S/C13H25NO/c1-3-5-6-7-8-9-10-11-12-14-13(15)4-2/h4H,2-3,5-12H2,1H3,(H,14,15) |
| InChIKey | AWDYCSUWSUENQK-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze N-decylprop-2-enamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-decylprop-2-enamide?
The IUPAC name of N-decylprop-2-enamide (CID 3018705) is N-decylprop-2-enamide.
What is the SMILES notation for N-decylprop-2-enamide?
The canonical SMILES for N-decylprop-2-enamide is C=CC(=O)NCCCCCCCCCC.
What is the InChIKey of N-decylprop-2-enamide?
The InChIKey is AWDYCSUWSUENQK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25NO/c1-3-5-6-7-8-9-10-11-12-14-13(15)4-2/h4H,2-3,5-12H2,1H3,(H,14,15).
What are the key properties of N-decylprop-2-enamide?
N-decylprop-2-enamide has a molecular weight of 211.35 g/mol, XLogP of 3.43, 10 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-decylprop-2-enamide is sourced from PubChem (CID 3018705), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).