C9H6F12O — CID 3018796
7-ethenoxy-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoroheptane (PubChem CID 3018796) has the molecular formula C9H6F12O and a molecular weight of 358.12 g/mol. Its IUPAC name is 7-ethenoxy-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoroheptane.
| Compound Name | 7-ethenoxy-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoroheptane |
|---|---|
| PubChem CID | 3018796 |
| Molecular Formula | C9H6F12O |
| Molecular Weight | 358.12 g/mol |
| Exact Mass | 358.02 |
| IUPAC Name | 7-ethenoxy-1,1,2,2,3,3,4,4,5,5,6,6-dodecafluoroheptane |
| SMILES | C=COCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)F |
| InChI | InChI=1S/C9H6F12O/c1-2-22-3-5(12,13)7(16,17)9(20,21)8(18,19)6(14,15)4(10)11/h2,4H,1,3H2 |
| InChIKey | PSLCNUISXILWOY-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.12 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|