About 3-tri(propan-2-yloxy)silylpropyl 2-methylprop-2-enoate
3-tri(propan-2-yloxy)silylpropyl 2-methylprop-2-enoate (PubChem CID 3018959) has the molecular formula C16H32O5Si
and a molecular weight of 332.51 g/mol. Its IUPAC name is 3-tri(propan-2-yloxy)silylpropyl 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | 3-tri(propan-2-yloxy)silylpropyl 2-methylprop-2-enoate |
| PubChem CID | 3018959 |
| Molecular Formula | C16H32O5Si |
| Molecular Weight | 332.51 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | 3-tri(propan-2-yloxy)silylpropyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCC[Si](OC(C)C)(OC(C)C)OC(C)C |
| InChI | InChI=1S/C16H32O5Si/c1-12(2)16(17)18-10-9-11-22(19-13(3)4,20-14(5)6)21-15(7)8/h13-15H,1,9-11H2,2-8H3 |
| InChIKey | CHPNMYQJQQGAJS-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.51 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-tri(propan-2-yloxy)silylpropyl 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-tri(propan-2-yloxy)silylpropyl 2-methylprop-2-enoate?
The IUPAC name of 3-tri(propan-2-yloxy)silylpropyl 2-methylprop-2-enoate (CID 3018959) is 3-tri(propan-2-yloxy)silylpropyl 2-methylprop-2-enoate.
What is the SMILES notation for 3-tri(propan-2-yloxy)silylpropyl 2-methylprop-2-enoate?
The canonical SMILES for 3-tri(propan-2-yloxy)silylpropyl 2-methylprop-2-enoate is C=C(C)C(=O)OCCC[Si](OC(C)C)(OC(C)C)OC(C)C.
What is the InChIKey of 3-tri(propan-2-yloxy)silylpropyl 2-methylprop-2-enoate?
The InChIKey is CHPNMYQJQQGAJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H32O5Si/c1-12(2)16(17)18-10-9-11-22(19-13(3)4,20-14(5)6)21-15(7)8/h13-15H,1,9-11H2,2-8H3.
What are the key properties of 3-tri(propan-2-yloxy)silylpropyl 2-methylprop-2-enoate?
3-tri(propan-2-yloxy)silylpropyl 2-methylprop-2-enoate has a molecular weight of 332.51 g/mol, XLogP of 3.71, 11 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-tri(propan-2-yloxy)silylpropyl 2-methylprop-2-enoate is sourced from PubChem (CID 3018959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).