About 5-methoxy-2-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-3H-inden-1-one
5-methoxy-2-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-3H-inden-1-one (PubChem CID 3018966) has the molecular formula C23H23NO2
and a molecular weight of 345.44 g/mol. Its IUPAC name is 5-methoxy-2-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-3H-inden-1-one.
Molecular Properties
| Compound Name | 5-methoxy-2-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-3H-inden-1-one |
| PubChem CID | 3018966 |
| Molecular Formula | C23H23NO2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | 5-methoxy-2-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-3H-inden-1-one |
| SMILES | COc1ccc2c(c1)CC(=CC=C1N(C)c3ccccc3C1(C)C)C2=O |
| InChI | InChI=1S/C23H23NO2/c1-23(2)19-7-5-6-8-20(19)24(3)21(23)12-9-15-13-16-14-17(26-4)10-11-18(16)22(15)25/h5-12,14H,13H2,1-4H3 |
| InChIKey | ZPOYEVJBRHNQGP-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 5-methoxy-2-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-3H-inden-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methoxy-2-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-3H-inden-1-one?
The IUPAC name of 5-methoxy-2-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-3H-inden-1-one (CID 3018966) is 5-methoxy-2-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-3H-inden-1-one.
What is the SMILES notation for 5-methoxy-2-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-3H-inden-1-one?
The canonical SMILES for 5-methoxy-2-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-3H-inden-1-one is COc1ccc2c(c1)CC(=CC=C1N(C)c3ccccc3C1(C)C)C2=O.
What is the InChIKey of 5-methoxy-2-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-3H-inden-1-one?
The InChIKey is ZPOYEVJBRHNQGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H23NO2/c1-23(2)19-7-5-6-8-20(19)24(3)21(23)12-9-15-13-16-14-17(26-4)10-11-18(16)22(15)25/h5-12,14H,13H2,1-4H3.
What are the key properties of 5-methoxy-2-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-3H-inden-1-one?
5-methoxy-2-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-3H-inden-1-one has a molecular weight of 345.44 g/mol, XLogP of 4.67, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methoxy-2-[2-(1,3,3-trimethylindol-2-ylidene)ethylidene]-3H-inden-1-one is sourced from PubChem (CID 3018966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).