C20H28N4O3S — CID 30190106
N-[4-[[4-[[(3S,5S)-3,5-dimethylpiperidin-1-yl]methyl]-1,3-thiazol-2-yl]amino]-4-oxobutyl]furan-2-carboxamide (PubChem CID 30190106) has the molecular formula C20H28N4O3S and a molecular weight of 404.54 g/mol. Its IUPAC name is N-[4-[[4-[[(3S,5S)-3,5-dimethylpiperidin-1-yl]methyl]-1,3-thiazol-2-yl]amino]-4-oxobutyl]furan-2-carboxamide.
| Compound Name | N-[4-[[4-[[(3S,5S)-3,5-dimethylpiperidin-1-yl]methyl]-1,3-thiazol-2-yl]amino]-4-oxobutyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 30190106 |
| Molecular Formula | C20H28N4O3S |
| Molecular Weight | 404.54 g/mol |
| Exact Mass | 404.19 |
| IUPAC Name | N-[4-[[4-[[(3S,5S)-3,5-dimethylpiperidin-1-yl]methyl]-1,3-thiazol-2-yl]amino]-4-oxobutyl]furan-2-carboxamide |
| SMILES | C[C@H]1C[C@H](C)CN(Cc2csc(NC(=O)CCCNC(=O)c3ccco3)n2)C1 |
| InChI | InChI=1S/C20H28N4O3S/c1-14-9-15(2)11-24(10-14)12-16-13-28-20(22-16)23-18(25)6-3-7-21-19(26)17-5-4-8-27-17/h4-5,8,13-15H,3,6-7,9-12H2,1-2H3,(H,21,26)(H,22,23,25)/t14-,15-/m0/s1 |
| InChIKey | JPOBYTVXPVXZFD-GJZGRUSLSA-N |
| XLogP | 3.36 |
| TPSA | 87.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.54 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|