C22H27NO3 — CID 3019148
1,3,3-trimethyl-2-[2-(2,4,6-trimethoxyphenyl)ethenyl]-2H-indole (PubChem CID 3019148) has the molecular formula C22H27NO3 and a molecular weight of 353.46 g/mol. Its IUPAC name is 1,3,3-trimethyl-2-[2-(2,4,6-trimethoxyphenyl)ethenyl]-2H-indole.
| Compound Name | 1,3,3-trimethyl-2-[2-(2,4,6-trimethoxyphenyl)ethenyl]-2H-indole |
|---|---|
| PubChem CID | 3019148 |
| Molecular Formula | C22H27NO3 |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.20 |
| IUPAC Name | 1,3,3-trimethyl-2-[2-(2,4,6-trimethoxyphenyl)ethenyl]-2H-indole |
| SMILES | COc1cc(OC)c(C=CC2N(C)c3ccccc3C2(C)C)c(OC)c1 |
| InChI | InChI=1S/C22H27NO3/c1-22(2)17-9-7-8-10-18(17)23(3)21(22)12-11-16-19(25-5)13-15(24-4)14-20(16)26-6/h7-14,21H,1-6H3 |
| InChIKey | JFOBLRLJJPZPDD-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |