C28H16Cl2N2O6 — CID 3019232
3-chloro-N-[5-[(4-chlorobenzoyl)amino]-4,8-dihydroxy-9,10-dioxoanthracen-1-yl]benzamide (PubChem CID 3019232) has the molecular formula C28H16Cl2N2O6 and a molecular weight of 547.35 g/mol. Its IUPAC name is 3-chloro-N-[5-[(4-chlorobenzoyl)amino]-4,8-dihydroxy-9,10-dioxoanthracen-1-yl]benzamide.
| Compound Name | 3-chloro-N-[5-[(4-chlorobenzoyl)amino]-4,8-dihydroxy-9,10-dioxoanthracen-1-yl]benzamide |
|---|---|
| PubChem CID | 3019232 |
| Molecular Formula | C28H16Cl2N2O6 |
| Molecular Weight | 547.35 g/mol |
| Exact Mass | 546.04 |
| IUPAC Name | 3-chloro-N-[5-[(4-chlorobenzoyl)amino]-4,8-dihydroxy-9,10-dioxoanthracen-1-yl]benzamide |
| SMILES | O=C(Nc1ccc(O)c2c1C(=O)c1c(O)ccc(NC(=O)c3cccc(Cl)c3)c1C2=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C28H16Cl2N2O6/c29-15-6-4-13(5-7-15)27(37)31-17-8-10-19(33)23-21(17)25(35)24-20(34)11-9-18(22(24)26(23)36)32-28(38)14-2-1-3-16(30)12-14/h1-12,33-34H,(H,31,37)(H,32,38) |
| InChIKey | VSVIXEIZLUKQCE-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.35 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|