About 2-(undecylamino)acetic acid
2-(undecylamino)acetic acid (PubChem CID 3019755) has the molecular formula C13H27NO2
and a molecular weight of 229.36 g/mol. Its IUPAC name is 2-(undecylamino)acetic acid.
Molecular Properties
| Compound Name | 2-(undecylamino)acetic acid |
| PubChem CID | 3019755 |
| Molecular Formula | C13H27NO2 |
| Molecular Weight | 229.36 g/mol |
| Exact Mass | 229.20 |
| IUPAC Name | 2-(undecylamino)acetic acid |
| SMILES | CCCCCCCCCCCNCC(=O)O |
| InChI | InChI=1S/C13H27NO2/c1-2-3-4-5-6-7-8-9-10-11-14-12-13(15)16/h14H,2-12H2,1H3,(H,15,16) |
| InChIKey | QZVLLXPELCRVPR-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.36 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-(undecylamino)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(undecylamino)acetic acid?
The IUPAC name of 2-(undecylamino)acetic acid (CID 3019755) is 2-(undecylamino)acetic acid.
What is the SMILES notation for 2-(undecylamino)acetic acid?
The canonical SMILES for 2-(undecylamino)acetic acid is CCCCCCCCCCCNCC(=O)O.
What is the InChIKey of 2-(undecylamino)acetic acid?
The InChIKey is QZVLLXPELCRVPR-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H27NO2/c1-2-3-4-5-6-7-8-9-10-11-14-12-13(15)16/h14H,2-12H2,1H3,(H,15,16).
What are the key properties of 2-(undecylamino)acetic acid?
2-(undecylamino)acetic acid has a molecular weight of 229.36 g/mol, XLogP of 3.19, 12 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(undecylamino)acetic acid is sourced from PubChem (CID 3019755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).