About 2-methyl-4-phenyldiazenylbenzene-1,3-diamine;hydrochloride
2-methyl-4-phenyldiazenylbenzene-1,3-diamine;hydrochloride (PubChem CID 3019870) has the molecular formula C13H15ClN4
and a molecular weight of 262.74 g/mol. Its IUPAC name is 2-methyl-4-phenyldiazenylbenzene-1,3-diamine;hydrochloride.
Molecular Properties
| Compound Name | 2-methyl-4-phenyldiazenylbenzene-1,3-diamine;hydrochloride |
| PubChem CID | 3019870 |
| Molecular Formula | C13H15ClN4 |
| Molecular Weight | 262.74 g/mol |
| Exact Mass | 262.10 |
| IUPAC Name | 2-methyl-4-phenyldiazenylbenzene-1,3-diamine;hydrochloride |
| SMILES | Cc1c(N)ccc(/N=N/c2ccccc2)c1N.Cl |
| InChI | InChI=1S/C13H14N4.ClH/c1-9-11(14)7-8-12(13(9)15)17-16-10-5-3-2-4-6-10;/h2-8H,14-15H2,1H3;1H/b17-16+; |
| InChIKey | PPUNNUBHWAOOHS-CMBBICFISA-N |
| XLogP | 4.00 |
| TPSA | 76.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.74 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 2-methyl-4-phenyldiazenylbenzene-1,3-diamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methyl-4-phenyldiazenylbenzene-1,3-diamine;hydrochloride?
The IUPAC name of 2-methyl-4-phenyldiazenylbenzene-1,3-diamine;hydrochloride (CID 3019870) is 2-methyl-4-phenyldiazenylbenzene-1,3-diamine;hydrochloride.
What is the SMILES notation for 2-methyl-4-phenyldiazenylbenzene-1,3-diamine;hydrochloride?
The canonical SMILES for 2-methyl-4-phenyldiazenylbenzene-1,3-diamine;hydrochloride is Cc1c(N)ccc(/N=N/c2ccccc2)c1N.Cl.
What is the InChIKey of 2-methyl-4-phenyldiazenylbenzene-1,3-diamine;hydrochloride?
The InChIKey is PPUNNUBHWAOOHS-CMBBICFISA-N. The full InChI is InChI=1S/C13H14N4.ClH/c1-9-11(14)7-8-12(13(9)15)17-16-10-5-3-2-4-6-10;/h2-8H,14-15H2,1H3;1H/b17-16+;.
What are the key properties of 2-methyl-4-phenyldiazenylbenzene-1,3-diamine;hydrochloride?
2-methyl-4-phenyldiazenylbenzene-1,3-diamine;hydrochloride has a molecular weight of 262.74 g/mol, XLogP of 4.00, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methyl-4-phenyldiazenylbenzene-1,3-diamine;hydrochloride is sourced from PubChem (CID 3019870), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).