About 3-methylsulfanylpropyl 3-methylbutanoate
3-methylsulfanylpropyl 3-methylbutanoate (PubChem CID 3019958) has the molecular formula C9H18O2S
and a molecular weight of 190.31 g/mol. Its IUPAC name is 3-methylsulfanylpropyl 3-methylbutanoate.
Molecular Properties
| Compound Name | 3-methylsulfanylpropyl 3-methylbutanoate |
| PubChem CID | 3019958 |
| Molecular Formula | C9H18O2S |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.10 |
| IUPAC Name | 3-methylsulfanylpropyl 3-methylbutanoate |
| SMILES | CSCCCOC(=O)CC(C)C |
| InChI | InChI=1S/C9H18O2S/c1-8(2)7-9(10)11-5-4-6-12-3/h8H,4-7H2,1-3H3 |
| InChIKey | XOTYBNFHVHYKJB-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 3-methylsulfanylpropyl 3-methylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylsulfanylpropyl 3-methylbutanoate?
The IUPAC name of 3-methylsulfanylpropyl 3-methylbutanoate (CID 3019958) is 3-methylsulfanylpropyl 3-methylbutanoate.
What is the SMILES notation for 3-methylsulfanylpropyl 3-methylbutanoate?
The canonical SMILES for 3-methylsulfanylpropyl 3-methylbutanoate is CSCCCOC(=O)CC(C)C.
What is the InChIKey of 3-methylsulfanylpropyl 3-methylbutanoate?
The InChIKey is XOTYBNFHVHYKJB-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O2S/c1-8(2)7-9(10)11-5-4-6-12-3/h8H,4-7H2,1-3H3.
What are the key properties of 3-methylsulfanylpropyl 3-methylbutanoate?
3-methylsulfanylpropyl 3-methylbutanoate has a molecular weight of 190.31 g/mol, XLogP of 2.33, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylsulfanylpropyl 3-methylbutanoate is sourced from PubChem (CID 3019958), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).