About non-1-en-3-yl formate
non-1-en-3-yl formate (PubChem CID 3020028) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is non-1-en-3-yl formate.
Molecular Properties
| Compound Name | non-1-en-3-yl formate |
| PubChem CID | 3020028 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | non-1-en-3-yl formate |
| SMILES | C=CC(CCCCCC)OC=O |
| InChI | InChI=1S/C10H18O2/c1-3-5-6-7-8-10(4-2)12-9-11/h4,9-10H,2-3,5-8H2,1H3 |
| InChIKey | BNHJRSKWTCEYEL-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze non-1-en-3-yl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of non-1-en-3-yl formate?
The IUPAC name of non-1-en-3-yl formate (CID 3020028) is non-1-en-3-yl formate.
What is the SMILES notation for non-1-en-3-yl formate?
The canonical SMILES for non-1-en-3-yl formate is C=CC(CCCCCC)OC=O.
What is the InChIKey of non-1-en-3-yl formate?
The InChIKey is BNHJRSKWTCEYEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O2/c1-3-5-6-7-8-10(4-2)12-9-11/h4,9-10H,2-3,5-8H2,1H3.
What are the key properties of non-1-en-3-yl formate?
non-1-en-3-yl formate has a molecular weight of 170.25 g/mol, XLogP of 2.68, 8 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for non-1-en-3-yl formate is sourced from PubChem (CID 3020028), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).