About 2-(ethylamino)-N,N-dimethylbutanamide
2-(ethylamino)-N,N-dimethylbutanamide (PubChem CID 3020137) has the molecular formula C8H18N2O
and a molecular weight of 158.24 g/mol. Its IUPAC name is 2-(ethylamino)-N,N-dimethylbutanamide.
Molecular Properties
| Compound Name | 2-(ethylamino)-N,N-dimethylbutanamide |
| PubChem CID | 3020137 |
| Molecular Formula | C8H18N2O |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.14 |
| IUPAC Name | 2-(ethylamino)-N,N-dimethylbutanamide |
| SMILES | CCNC(CC)C(=O)N(C)C |
| InChI | InChI=1S/C8H18N2O/c1-5-7(9-6-2)8(11)10(3)4/h7,9H,5-6H2,1-4H3 |
| InChIKey | WDMZZHGFIDHAFR-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-(ethylamino)-N,N-dimethylbutanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(ethylamino)-N,N-dimethylbutanamide?
The IUPAC name of 2-(ethylamino)-N,N-dimethylbutanamide (CID 3020137) is 2-(ethylamino)-N,N-dimethylbutanamide.
What is the SMILES notation for 2-(ethylamino)-N,N-dimethylbutanamide?
The canonical SMILES for 2-(ethylamino)-N,N-dimethylbutanamide is CCNC(CC)C(=O)N(C)C.
What is the InChIKey of 2-(ethylamino)-N,N-dimethylbutanamide?
The InChIKey is WDMZZHGFIDHAFR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H18N2O/c1-5-7(9-6-2)8(11)10(3)4/h7,9H,5-6H2,1-4H3.
What are the key properties of 2-(ethylamino)-N,N-dimethylbutanamide?
2-(ethylamino)-N,N-dimethylbutanamide has a molecular weight of 158.24 g/mol, XLogP of 0.46, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(ethylamino)-N,N-dimethylbutanamide is sourced from PubChem (CID 3020137), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).