C19H23ClO6 — CID 3020141
diethyl 2,4-diacetyl-3-(4-chlorophenyl)pentanedioate (PubChem CID 3020141) has the molecular formula C19H23ClO6 and a molecular weight of 382.84 g/mol. Its IUPAC name is diethyl 2,4-diacetyl-3-(4-chlorophenyl)pentanedioate.
| Compound Name | diethyl 2,4-diacetyl-3-(4-chlorophenyl)pentanedioate |
|---|---|
| PubChem CID | 3020141 |
| Molecular Formula | C19H23ClO6 |
| Molecular Weight | 382.84 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | diethyl 2,4-diacetyl-3-(4-chlorophenyl)pentanedioate |
| SMILES | CCOC(=O)C(C(C)=O)C(c1ccc(Cl)cc1)C(C(C)=O)C(=O)OCC |
| InChI | InChI=1S/C19H23ClO6/c1-5-25-18(23)15(11(3)21)17(13-7-9-14(20)10-8-13)16(12(4)22)19(24)26-6-2/h7-10,15-17H,5-6H2,1-4H3 |
| InChIKey | DNQLYCOOQIWASI-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 86.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.84 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|