4-hydroxy-2,3-dimethylbenzenesulfonic acid

C8H10O4S — CID 3020229

IUPAC4-hydroxy-2,3-dimethylbenzenesulfonic acid
SMILESCc1c(O)ccc(S(=O)(=O)O)c1C
InChIInChI=1S/C8H10O4S/c1-5-6(2)8(13(10,11)12)4-3-7(5)9/h3-4,9H,1-2H3,(H,10,11,12)
InChIKeyZXPLMIDGCZOIIR-UHFFFAOYSA-N
MW202.23 g/mol
LogP1.26
Rot. Bonds1

About 4-hydroxy-2,3-dimethylbenzenesulfonic acid

4-hydroxy-2,3-dimethylbenzenesulfonic acid (PubChem CID 3020229) has the molecular formula C8H10O4S and a molecular weight of 202.23 g/mol. Its IUPAC name is 4-hydroxy-2,3-dimethylbenzenesulfonic acid.

Molecular Properties

Compound Name4-hydroxy-2,3-dimethylbenzenesulfonic acid
PubChem CID3020229
Molecular FormulaC8H10O4S
Molecular Weight202.23 g/mol
Exact Mass202.03
IUPAC Name4-hydroxy-2,3-dimethylbenzenesulfonic acid
SMILESCc1c(O)ccc(S(=O)(=O)O)c1C
InChIInChI=1S/C8H10O4S/c1-5-6(2)8(13(10,11)12)4-3-7(5)9/h3-4,9H,1-2H3,(H,10,11,12)
InChIKeyZXPLMIDGCZOIIR-UHFFFAOYSA-N
XLogP1.26
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500202.23
LogP ≤ 51.26
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}

Analyze 4-hydroxy-2,3-dimethylbenzenesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-hydroxy-2,3-dimethylbenzenesulfonic acid?
The IUPAC name of 4-hydroxy-2,3-dimethylbenzenesulfonic acid (CID 3020229) is 4-hydroxy-2,3-dimethylbenzenesulfonic acid.
What is the SMILES notation for 4-hydroxy-2,3-dimethylbenzenesulfonic acid?
The canonical SMILES for 4-hydroxy-2,3-dimethylbenzenesulfonic acid is Cc1c(O)ccc(S(=O)(=O)O)c1C.
What is the InChIKey of 4-hydroxy-2,3-dimethylbenzenesulfonic acid?
The InChIKey is ZXPLMIDGCZOIIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10O4S/c1-5-6(2)8(13(10,11)12)4-3-7(5)9/h3-4,9H,1-2H3,(H,10,11,12).
What are the key properties of 4-hydroxy-2,3-dimethylbenzenesulfonic acid?
4-hydroxy-2,3-dimethylbenzenesulfonic acid has a molecular weight of 202.23 g/mol, XLogP of 1.26, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hydroxy-2,3-dimethylbenzenesulfonic acid is sourced from PubChem (CID 3020229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).