C21H26N7NaO7S — CID 3020246
sodium 2-[[5-cyano-2,6-bis(3-methoxypropylamino)-4-methyl-3-pyridinyl]diazenyl]-5-nitrobenzenesulfonate (PubChem CID 3020246) has the molecular formula C21H26N7NaO7S and a molecular weight of 543.54 g/mol. Its IUPAC name is sodium 2-[[5-cyano-2,6-bis(3-methoxypropylamino)-4-methyl-3-pyridinyl]diazenyl]-5-nitrobenzenesulfonate.
| Compound Name | sodium 2-[[5-cyano-2,6-bis(3-methoxypropylamino)-4-methyl-3-pyridinyl]diazenyl]-5-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 3020246 |
| Molecular Formula | C21H26N7NaO7S |
| Molecular Weight | 543.54 g/mol |
| Exact Mass | 543.15 |
| IUPAC Name | sodium 2-[[5-cyano-2,6-bis(3-methoxypropylamino)-4-methyl-3-pyridinyl]diazenyl]-5-nitrobenzenesulfonate |
| SMILES | COCCCNc1nc(NCCCOC)c(/N=N/c2ccc([N+](=O)[O-])cc2S(=O)(=O)[O-])c(C)c1C#N.[Na+] |
| InChI | InChI=1S/C21H27N7O7S.Na/c1-14-16(13-22)20(23-8-4-10-34-2)25-21(24-9-5-11-35-3)19(14)27-26-17-7-6-15(28(29)30)12-18(17)36(31,32)33;/h6-7,12H,4-5,8-11H2,1-3H3,(H2,23,24,25)(H,31,32,33);/q;+1/p-1/b27-26+; |
| InChIKey | UPXRUNLIBXFYIL-JGUILPGDSA-M |
| XLogP | 0.39 |
| TPSA | 204.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.54 |
| LogP ≤ 5 | 0.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|