About 4-(1-aminopropyl)phenol
4-(1-aminopropyl)phenol (PubChem CID 3020319) has the molecular formula C9H13NO
and a molecular weight of 151.21 g/mol. Its IUPAC name is 4-(1-aminopropyl)phenol.
Molecular Properties
| Compound Name | 4-(1-aminopropyl)phenol |
| PubChem CID | 3020319 |
| Molecular Formula | C9H13NO |
| Molecular Weight | 151.21 g/mol |
| Exact Mass | 151.10 |
| IUPAC Name | 4-(1-aminopropyl)phenol |
| SMILES | CCC(N)c1ccc(O)cc1 |
| InChI | InChI=1S/C9H13NO/c1-2-9(10)7-3-5-8(11)6-4-7/h3-6,9,11H,2,10H2,1H3 |
| InChIKey | WTQZYHPAVNTISM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.21 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-(1-aminopropyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(1-aminopropyl)phenol?
The IUPAC name of 4-(1-aminopropyl)phenol (CID 3020319) is 4-(1-aminopropyl)phenol.
What is the SMILES notation for 4-(1-aminopropyl)phenol?
The canonical SMILES for 4-(1-aminopropyl)phenol is CCC(N)c1ccc(O)cc1.
What is the InChIKey of 4-(1-aminopropyl)phenol?
The InChIKey is WTQZYHPAVNTISM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO/c1-2-9(10)7-3-5-8(11)6-4-7/h3-6,9,11H,2,10H2,1H3.
What are the key properties of 4-(1-aminopropyl)phenol?
4-(1-aminopropyl)phenol has a molecular weight of 151.21 g/mol, XLogP of 1.80, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(1-aminopropyl)phenol is sourced from PubChem (CID 3020319), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).