About N,N-diethyl-3-oxobutanamide;hydrochloride
N,N-diethyl-3-oxobutanamide;hydrochloride (PubChem CID 3020440) has the molecular formula C8H16ClNO2
and a molecular weight of 193.67 g/mol. Its IUPAC name is N,N-diethyl-3-oxobutanamide;hydrochloride.
Molecular Properties
| Compound Name | N,N-diethyl-3-oxobutanamide;hydrochloride |
| PubChem CID | 3020440 |
| Molecular Formula | C8H16ClNO2 |
| Molecular Weight | 193.67 g/mol |
| Exact Mass | 193.09 |
| IUPAC Name | N,N-diethyl-3-oxobutanamide;hydrochloride |
| SMILES | CCN(CC)C(=O)CC(C)=O.Cl |
| InChI | InChI=1S/C8H15NO2.ClH/c1-4-9(5-2)8(11)6-7(3)10;/h4-6H2,1-3H3;1H |
| InChIKey | CJCNCCAZYAUMAB-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.67 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethyl-3-oxobutanamide;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-3-oxobutanamide;hydrochloride?
The IUPAC name of N,N-diethyl-3-oxobutanamide;hydrochloride (CID 3020440) is N,N-diethyl-3-oxobutanamide;hydrochloride.
What is the SMILES notation for N,N-diethyl-3-oxobutanamide;hydrochloride?
The canonical SMILES for N,N-diethyl-3-oxobutanamide;hydrochloride is CCN(CC)C(=O)CC(C)=O.Cl.
What is the InChIKey of N,N-diethyl-3-oxobutanamide;hydrochloride?
The InChIKey is CJCNCCAZYAUMAB-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO2.ClH/c1-4-9(5-2)8(11)6-7(3)10;/h4-6H2,1-3H3;1H.
What are the key properties of N,N-diethyl-3-oxobutanamide;hydrochloride?
N,N-diethyl-3-oxobutanamide;hydrochloride has a molecular weight of 193.67 g/mol, XLogP of 1.26, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-3-oxobutanamide;hydrochloride is sourced from PubChem (CID 3020440), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).