About 5,6-dibutylundecan-5-amine
5,6-dibutylundecan-5-amine (PubChem CID 3020485) has the molecular formula C19H41N
and a molecular weight of 283.54 g/mol. Its IUPAC name is 5,6-dibutylundecan-5-amine.
Molecular Properties
| Compound Name | 5,6-dibutylundecan-5-amine |
| PubChem CID | 3020485 |
| Molecular Formula | C19H41N |
| Molecular Weight | 283.54 g/mol |
| Exact Mass | 283.32 |
| IUPAC Name | 5,6-dibutylundecan-5-amine |
| SMILES | CCCCCC(CCCC)C(N)(CCCC)CCCC |
| InChI | InChI=1S/C19H41N/c1-5-9-13-15-18(14-10-6-2)19(20,16-11-7-3)17-12-8-4/h18H,5-17,20H2,1-4H3 |
| InChIKey | FSNGUXFIPIMNSJ-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 283.54 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5,6-dibutylundecan-5-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dibutylundecan-5-amine?
The IUPAC name of 5,6-dibutylundecan-5-amine (CID 3020485) is 5,6-dibutylundecan-5-amine.
What is the SMILES notation for 5,6-dibutylundecan-5-amine?
The canonical SMILES for 5,6-dibutylundecan-5-amine is CCCCCC(CCCC)C(N)(CCCC)CCCC.
What is the InChIKey of 5,6-dibutylundecan-5-amine?
The InChIKey is FSNGUXFIPIMNSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H41N/c1-5-9-13-15-18(14-10-6-2)19(20,16-11-7-3)17-12-8-4/h18H,5-17,20H2,1-4H3.
What are the key properties of 5,6-dibutylundecan-5-amine?
5,6-dibutylundecan-5-amine has a molecular weight of 283.54 g/mol, XLogP of 6.45, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dibutylundecan-5-amine is sourced from PubChem (CID 3020485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).